C21H25N3O2 — CID 50858355
4-[(2E)-2-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]hydrazinyl]benzoic acid (PubChem CID 50858355) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[(2E)-2-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[(2E)-2-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 50858355 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[(2E)-2-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]hydrazinyl]benzoic acid |
| SMILES | CC1CC(C)(C)N(C)c2ccc(/C=N/Nc3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C21H25N3O2/c1-14-12-21(2,3)24(4)19-10-5-15(11-18(14)19)13-22-23-17-8-6-16(7-9-17)20(25)26/h5-11,13-14,23H,12H2,1-4H3,(H,25,26)/b22-13+ |
| InChIKey | VJUYOCPFAIUWKU-LPYMAVHISA-N |
| XLogP | 4.55 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|