C21H26N4S — CID 50858282
1-phenyl-3-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiourea (PubChem CID 50858282) has the molecular formula C21H26N4S and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-phenyl-3-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiourea.
| Compound Name | 1-phenyl-3-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 50858282 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-phenyl-3-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiourea |
| SMILES | CC1CC(C)(C)N(C)c2ccc(/C=N/NC(=S)Nc3ccccc3)cc21 |
| InChI | InChI=1S/C21H26N4S/c1-15-13-21(2,3)25(4)19-11-10-16(12-18(15)19)14-22-24-20(26)23-17-8-6-5-7-9-17/h5-12,14-15H,13H2,1-4H3,(H2,23,24,26)/b22-14+ |
| InChIKey | RHRIWDQIFUSTON-HYARGMPZSA-N |
| XLogP | 4.73 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|