C22H27FN4S — CID 50861324
1-[(E)-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-phenylthiourea (PubChem CID 50861324) has the molecular formula C22H27FN4S and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[(E)-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 50861324 |
| Molecular Formula | C22H27FN4S |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[(E)-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-phenylthiourea |
| SMILES | CCN1c2cc(F)c(/C=N/NC(=S)Nc3ccccc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H27FN4S/c1-5-27-20-12-19(23)16(11-18(20)15(2)13-22(27,3)4)14-24-26-21(28)25-17-9-7-6-8-10-17/h6-12,14-15H,5,13H2,1-4H3,(H2,25,26,28)/b24-14+ |
| InChIKey | XSQCQBCHQPXHKA-ZVHZXABRSA-N |
| XLogP | 5.26 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|