C23H27FIN3O — CID 50863276
N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-iodobenzamide (PubChem CID 50863276) has the molecular formula C23H27FIN3O and a molecular weight of 507.39 g/mol. Its IUPAC name is N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-iodobenzamide.
| Compound Name | N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-iodobenzamide |
|---|---|
| PubChem CID | 50863276 |
| Molecular Formula | C23H27FIN3O |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-iodobenzamide |
| SMILES | CCCN1c2cc(F)c(/C=N\NC(=O)c3cccc(I)c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C23H27FIN3O/c1-5-9-28-21-12-20(24)17(11-19(21)15(2)13-23(28,3)4)14-26-27-22(29)16-7-6-8-18(25)10-16/h6-8,10-12,14-15H,5,9,13H2,1-4H3,(H,27,29)/b26-14- |
| InChIKey | SDNSHLFMGBBNPW-WGARJPEWSA-N |
| XLogP | 5.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|