C23H27ClN4O3 — CID 50862900
N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-nitrobenzamide (PubChem CID 50862900) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 50862900 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-nitrobenzamide |
| SMILES | CCCN1c2cc(Cl)c(/C=N\NC(=O)c3cccc([N+](=O)[O-])c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C23H27ClN4O3/c1-5-9-27-21-12-20(24)17(11-19(21)15(2)13-23(27,3)4)14-25-26-22(29)16-7-6-8-18(10-16)28(30)31/h6-8,10-12,14-15H,5,9,13H2,1-4H3,(H,26,29)/b25-14- |
| InChIKey | GWQOIAFOTQMKBG-QFEZKATASA-N |
| XLogP | 5.51 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|