C23H26Br2ClN3O2 — CID 50862871
3,5-dibromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-hydroxybenzamide (PubChem CID 50862871) has the molecular formula C23H26Br2ClN3O2 and a molecular weight of 571.74 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 50862871 |
| Molecular Formula | C23H26Br2ClN3O2 |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 569.01 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-hydroxybenzamide |
| SMILES | CCCN1c2cc(Cl)c(/C=N\NC(=O)c3cc(Br)cc(Br)c3O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C23H26Br2ClN3O2/c1-5-6-29-20-10-19(26)14(7-16(20)13(2)11-23(29,3)4)12-27-28-22(31)17-8-15(24)9-18(25)21(17)30/h7-10,12-13,30H,5-6,11H2,1-4H3,(H,28,31)/b27-12- |
| InChIKey | DHPUSMXSIULFCH-PPDIBHTLSA-N |
| XLogP | 6.84 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|