C22H24Cl3N3O — CID 50860928
2,4-dichloro-N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50860928) has the molecular formula C22H24Cl3N3O and a molecular weight of 452.81 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50860928 |
| Molecular Formula | C22H24Cl3N3O |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCN1c2cc(Cl)c(/C=N\NC(=O)c3ccc(Cl)cc3Cl)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H24Cl3N3O/c1-5-28-20-10-18(24)14(8-17(20)13(2)11-22(28,3)4)12-26-27-21(29)16-7-6-15(23)9-19(16)25/h6-10,12-13H,5,11H2,1-4H3,(H,27,29)/b26-12- |
| InChIKey | CXUDZUOTFKLITR-ZRGSRPPYSA-N |
| XLogP | 6.52 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|