C22H24Br2ClN3O2 — CID 50861199
3,5-dibromo-N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-4-hydroxybenzamide (PubChem CID 50861199) has the molecular formula C22H24Br2ClN3O2 and a molecular weight of 557.71 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 50861199 |
| Molecular Formula | C22H24Br2ClN3O2 |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 554.99 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-4-hydroxybenzamide |
| SMILES | CCN1c2cc(Cl)c(/C=N\NC(=O)c3cc(Br)c(O)c(Br)c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H24Br2ClN3O2/c1-5-28-19-9-18(25)14(6-15(19)12(2)10-22(28,3)4)11-26-27-21(30)13-7-16(23)20(29)17(24)8-13/h6-9,11-12,29H,5,10H2,1-4H3,(H,27,30)/b26-11- |
| InChIKey | DDNNJQLWGNSAEH-RAWMCFOBSA-N |
| XLogP | 6.45 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|