C22H25Br2N3O2 — CID 50858412
3,5-dibromo-4-hydroxy-N-[(Z)-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50858412) has the molecular formula C22H25Br2N3O2 and a molecular weight of 523.27 g/mol. Its IUPAC name is 3,5-dibromo-4-hydroxy-N-[(Z)-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 3,5-dibromo-4-hydroxy-N-[(Z)-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50858412 |
| Molecular Formula | C22H25Br2N3O2 |
| Molecular Weight | 523.27 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 3,5-dibromo-4-hydroxy-N-[(Z)-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | Cc1cc2c(cc1/C=N\NC(=O)c1cc(Br)c(O)c(Br)c1)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C22H25Br2N3O2/c1-12-6-19-16(13(2)10-22(3,4)27(19)5)7-15(12)11-25-26-21(29)14-8-17(23)20(28)18(24)9-14/h6-9,11,13,28H,10H2,1-5H3,(H,26,29)/b25-11- |
| InChIKey | HVSAPZOFIOEDIP-GATIEOLUSA-N |
| XLogP | 5.71 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.27 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|