C26H30N4O — CID 99885692
N-[(Z)-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-2-pyrrol-1-ylbenzamide (PubChem CID 99885692) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[(Z)-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-2-pyrrol-1-ylbenzamide.
| Compound Name | N-[(Z)-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-2-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 99885692 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | N-[(Z)-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-2-pyrrol-1-ylbenzamide |
| SMILES | Cc1cc2c(cc1/C=N\NC(=O)c1ccccc1-n1cccc1)[C@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C26H30N4O/c1-18-14-24-22(19(2)16-26(3,4)29(24)5)15-20(18)17-27-28-25(31)21-10-6-7-11-23(21)30-12-8-9-13-30/h6-15,17,19H,16H2,1-5H3,(H,28,31)/b27-17-/t19-/m1/s1 |
| InChIKey | IFXJBKORXNMHGE-VXIMLZEYSA-N |
| XLogP | 5.27 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|