C23H29N3O — CID 99885786
N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-2-phenylacetamide (PubChem CID 99885786) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 99885786 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-2-phenylacetamide |
| SMILES | Cc1cc2c(cc1/C=N\NC(=O)Cc1ccccc1)[C@@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C23H29N3O/c1-16-11-21-20(17(2)14-23(3,4)26(21)5)13-19(16)15-24-25-22(27)12-18-9-7-6-8-10-18/h6-11,13,15,17H,12,14H2,1-5H3,(H,25,27)/b24-15-/t17-/m0/s1 |
| InChIKey | TYDILLKZLXNHOD-HZRSJKMUSA-N |
| XLogP | 4.41 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|