C26H35N3O — CID 50862606
3-phenyl-N-[(E)-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]propanamide (PubChem CID 50862606) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 3-phenyl-N-[(E)-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]propanamide.
| Compound Name | 3-phenyl-N-[(E)-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 50862606 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 3-phenyl-N-[(E)-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]propanamide |
| SMILES | CCCN1c2cc(C)c(/C=N/NC(=O)CCc3ccccc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C26H35N3O/c1-6-14-29-24-15-19(2)22(16-23(24)20(3)17-26(29,4)5)18-27-28-25(30)13-12-21-10-8-7-9-11-21/h7-11,15-16,18,20H,6,12-14,17H2,1-5H3,(H,28,30)/b27-18+ |
| InChIKey | AEQSMZPKIWEOIG-OVVQPSECSA-N |
| XLogP | 5.58 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|