C24H32N2O — CID 50862689
N-(2-methoxyphenyl)-1-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50862689) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(2-methoxyphenyl)-1-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50862689 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-(2-methoxyphenyl)-1-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccccc3OC)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H32N2O/c1-7-12-26-22-13-17(2)19(14-20(22)18(3)15-24(26,4)5)16-25-21-10-8-9-11-23(21)27-6/h8-11,13-14,16,18H,7,12,15H2,1-6H3/b25-16+ |
| InChIKey | SWHYEZLUEIMWME-PCLIKHOPSA-N |
| XLogP | 6.26 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|