C23H28F2N2O — CID 50863685
N-(2,4-difluorophenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50863685) has the molecular formula C23H28F2N2O and a molecular weight of 386.49 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(2,4-difluorophenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50863685 |
| Molecular Formula | C23H28F2N2O |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(OC)c(/C=N/c3ccc(F)cc3F)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C23H28F2N2O/c1-6-9-27-21-12-22(28-5)16(10-18(21)15(2)13-23(27,3)4)14-26-20-8-7-17(24)11-19(20)25/h7-8,10-12,14-15H,6,9,13H2,1-5H3/b26-14+ |
| InChIKey | QWPAMJLHXJEVSD-VULFUBBASA-N |
| XLogP | 6.23 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|