C21H24F2N2 — CID 50858536
N-(2,4-difluorophenyl)-1-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50858536) has the molecular formula C21H24F2N2 and a molecular weight of 342.43 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(2,4-difluorophenyl)-1-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50858536 |
| Molecular Formula | C21H24F2N2 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | Cc1cc2c(cc1/C=N/c1ccc(F)cc1F)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C21H24F2N2/c1-13-8-20-17(14(2)11-21(3,4)25(20)5)9-15(13)12-24-19-7-6-16(22)10-18(19)23/h6-10,12,14H,11H2,1-5H3/b24-12+ |
| InChIKey | AOWSVGIANCOIAE-WYMPLXKRSA-N |
| XLogP | 5.75 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|