C23H28N2O2 — CID 50858748
4-methyl-3-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzoic acid (PubChem CID 50858748) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-methyl-3-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzoic acid.
| Compound Name | 4-methyl-3-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 50858748 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-methyl-3-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzoic acid |
| SMILES | Cc1cc2c(cc1/C=N/c1cc(C(=O)O)ccc1C)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C23H28N2O2/c1-14-7-8-17(22(26)27)11-20(14)24-13-18-10-19-16(3)12-23(4,5)25(6)21(19)9-15(18)2/h7-11,13,16H,12H2,1-6H3,(H,26,27)/b24-13+ |
| InChIKey | NUBQIZAWRFNYFM-ZMOGYAJESA-N |
| XLogP | 5.47 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|