C23H28N2O2 — CID 50858676
methyl 4-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzoate (PubChem CID 50858676) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is methyl 4-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzoate.
| Compound Name | methyl 4-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 50858676 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | methyl 4-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C/c2cc3c(cc2C)N(C)C(C)(C)CC3C)cc1 |
| InChI | InChI=1S/C23H28N2O2/c1-15-11-21-20(16(2)13-23(3,4)25(21)5)12-18(15)14-24-19-9-7-17(8-10-19)22(26)27-6/h7-12,14,16H,13H2,1-6H3/b24-14+ |
| InChIKey | UNVVSHXNCMQJIT-ZVHZXABRSA-N |
| XLogP | 5.25 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|