C28H32N2O2 — CID 50858687
N-[4-(3-methoxyphenoxy)phenyl]-1-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50858687) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[4-(3-methoxyphenoxy)phenyl]-1-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-[4-(3-methoxyphenoxy)phenyl]-1-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50858687 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-[4-(3-methoxyphenoxy)phenyl]-1-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | COc1cccc(Oc2ccc(/N=C/c3cc4c(cc3C)N(C)C(C)(C)CC4C)cc2)c1 |
| InChI | InChI=1S/C28H32N2O2/c1-19-14-27-26(20(2)17-28(3,4)30(27)5)15-21(19)18-29-22-10-12-23(13-11-22)32-25-9-7-8-24(16-25)31-6/h7-16,18,20H,17H2,1-6H3/b29-18+ |
| InChIKey | UWUJILPWITWOLM-RDRPBHBLSA-N |
| XLogP | 7.27 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|