C26H27ClN2O — CID 50859359
1-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-N-(4-phenoxyphenyl)methanimine (PubChem CID 50859359) has the molecular formula C26H27ClN2O and a molecular weight of 418.97 g/mol. Its IUPAC name is 1-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 50859359 |
| Molecular Formula | C26H27ClN2O |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-N-(4-phenoxyphenyl)methanimine |
| SMILES | CC1CC(C)(C)N(C)c2cc(Cl)c(/C=N/c3ccc(Oc4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C26H27ClN2O/c1-18-16-26(2,3)29(4)25-15-24(27)19(14-23(18)25)17-28-20-10-12-22(13-11-20)30-21-8-6-5-7-9-21/h5-15,17-18H,16H2,1-4H3/b28-17+ |
| InChIKey | RVWIKEBILOIGAJ-OGLMXYFKSA-N |
| XLogP | 7.60 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|