C20H24ClN3 — CID 99886342
N-[(Z)-[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]aniline (PubChem CID 99886342) has the molecular formula C20H24ClN3 and a molecular weight of 341.89 g/mol. Its IUPAC name is N-[(Z)-[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]aniline.
| Compound Name | N-[(Z)-[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 99886342 |
| Molecular Formula | C20H24ClN3 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[(Z)-[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]aniline |
| SMILES | C[C@@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=N\Nc3ccccc3)cc21 |
| InChI | InChI=1S/C20H24ClN3/c1-14-12-20(2,3)24(4)19-11-18(21)15(10-17(14)19)13-22-23-16-8-6-5-7-9-16/h5-11,13-14,23H,12H2,1-4H3/b22-13-/t14-/m1/s1 |
| InChIKey | OQULYCYENRQZJZ-BXSODOALSA-N |
| XLogP | 5.51 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|