C21H25ClN4S — CID 99886483
1-[(E)-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-3-phenylthiourea (PubChem CID 99886483) has the molecular formula C21H25ClN4S and a molecular weight of 400.98 g/mol. Its IUPAC name is 1-[(E)-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 99886483 |
| Molecular Formula | C21H25ClN4S |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[(E)-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-3-phenylthiourea |
| SMILES | C[C@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=N/NC(=S)Nc3ccccc3)cc21 |
| InChI | InChI=1S/C21H25ClN4S/c1-14-12-21(2,3)26(4)19-11-18(22)15(10-17(14)19)13-23-25-20(27)24-16-8-6-5-7-9-16/h5-11,13-14H,12H2,1-4H3,(H2,24,25,27)/b23-13+/t14-/m0/s1 |
| InChIKey | OHCLSFKVHFHJFO-WQEJZQBCSA-N |
| XLogP | 5.38 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|