C22H28N4O — CID 99885758
1-[(E)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-3-phenylurea (PubChem CID 99885758) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[(E)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 99885758 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1-[(E)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-3-phenylurea |
| SMILES | Cc1cc2c(cc1/C=N/NC(=O)Nc1ccccc1)[C@@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C22H28N4O/c1-15-11-20-19(16(2)13-22(3,4)26(20)5)12-17(15)14-23-25-21(27)24-18-9-7-6-8-10-18/h6-12,14,16H,13H2,1-5H3,(H2,24,25,27)/b23-14+/t16-/m0/s1 |
| InChIKey | JSGVYKDUWAYNNN-YQCVNYCESA-N |
| XLogP | 4.87 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|