C27H31N3O — CID 99885807
2-naphthalen-1-yl-N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]acetamide (PubChem CID 99885807) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]acetamide.
| Compound Name | 2-naphthalen-1-yl-N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 99885807 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 2-naphthalen-1-yl-N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]acetamide |
| SMILES | Cc1cc2c(cc1/C=N\NC(=O)Cc1cccc3ccccc13)[C@@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C27H31N3O/c1-18-13-25-24(19(2)16-27(3,4)30(25)5)14-22(18)17-28-29-26(31)15-21-11-8-10-20-9-6-7-12-23(20)21/h6-14,17,19H,15-16H2,1-5H3,(H,29,31)/b28-17-/t19-/m0/s1 |
| InChIKey | CPPSZFHPTKGDBN-JTOGBTRBSA-N |
| XLogP | 5.56 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|