C24H31N3O — CID 50860662
N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-phenylacetamide (PubChem CID 50860662) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 50860662 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-phenylacetamide |
| SMILES | CCN1c2cc(C)c(/C=N\NC(=O)Cc3ccccc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H31N3O/c1-6-27-22-12-17(2)20(14-21(22)18(3)15-24(27,4)5)16-25-26-23(28)13-19-10-8-7-9-11-19/h7-12,14,16,18H,6,13,15H2,1-5H3,(H,26,28)/b25-16- |
| InChIKey | GABJBHSUUBDPTR-XYGWBWBKSA-N |
| XLogP | 4.80 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|