C21H27N3OS — CID 133170605
N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiophene-2-carboxamide (PubChem CID 133170605) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 133170605 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiophene-2-carboxamide |
| SMILES | CCN1c2cc(C)c(/C=N\NC(=O)c3cccs3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C21H27N3OS/c1-6-24-18-10-14(2)16(11-17(18)15(3)12-21(24,4)5)13-22-23-20(25)19-8-7-9-26-19/h7-11,13,15H,6,12H2,1-5H3,(H,23,25)/b22-13- |
| InChIKey | VWLYSBIUKYKAPM-XKZIYDEJSA-N |
| XLogP | 4.93 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|