C25H33N3O2 — CID 50860529
N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-methoxy-4-methylbenzamide (PubChem CID 50860529) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-methoxy-4-methylbenzamide.
| Compound Name | N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 50860529 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-methoxy-4-methylbenzamide |
| SMILES | CCN1c2cc(C)c(/C=N\NC(=O)c3ccc(C)cc3OC)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C25H33N3O2/c1-8-28-22-12-17(3)19(13-21(22)18(4)14-25(28,5)6)15-26-27-24(29)20-10-9-16(2)11-23(20)30-7/h9-13,15,18H,8,14H2,1-7H3,(H,27,29)/b26-15- |
| InChIKey | TVHVKZRFOSPOBJ-YSMPRRRNSA-N |
| XLogP | 5.19 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|