C26H35N3O3 — CID 50863864
2-methoxy-N-[(Z)-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-4-methylbenzamide (PubChem CID 50863864) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-methoxy-N-[(Z)-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-4-methylbenzamide.
| Compound Name | 2-methoxy-N-[(Z)-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 50863864 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 2-methoxy-N-[(Z)-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-4-methylbenzamide |
| SMILES | CCCN1c2cc(OC)c(/C=N\NC(=O)c3ccc(C)cc3OC)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C26H35N3O3/c1-8-11-29-22-14-23(31-6)19(13-21(22)18(3)15-26(29,4)5)16-27-28-25(30)20-10-9-17(2)12-24(20)32-7/h9-10,12-14,16,18H,8,11,15H2,1-7H3,(H,28,30)/b27-16- |
| InChIKey | ZIPXKUNWILHSSZ-YUMHPJSZSA-N |
| XLogP | 5.28 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|