C24H29Cl2N3O — CID 50862635
2,4-dichloro-N-[(Z)-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50862635) has the molecular formula C24H29Cl2N3O and a molecular weight of 446.42 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50862635 |
| Molecular Formula | C24H29Cl2N3O |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2cc(C)c(/C=N\NC(=O)c3ccc(Cl)cc3Cl)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H29Cl2N3O/c1-6-9-29-22-10-15(2)17(11-20(22)16(3)13-24(29,4)5)14-27-28-23(30)19-8-7-18(25)12-21(19)26/h7-8,10-12,14,16H,6,9,13H2,1-5H3,(H,28,30)/b27-14- |
| InChIKey | GVKQFGRUPUZUOU-VYYCAZPPSA-N |
| XLogP | 6.57 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|