C25H32ClN3O — CID 133170688
2-chloro-4-methyl-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 133170688) has the molecular formula C25H32ClN3O and a molecular weight of 426.00 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 133170688 |
| Molecular Formula | C25H32ClN3O |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-chloro-4-methyl-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc(C(=O)N/N=C/c2cc3c(cc2C)N(C(C)C)C(C)(C)CC3C)c(Cl)c1 |
| InChI | InChI=1S/C25H32ClN3O/c1-15(2)29-23-11-17(4)19(12-21(23)18(5)13-25(29,6)7)14-27-28-24(30)20-9-8-16(3)10-22(20)26/h8-12,14-15,18H,13H2,1-7H3,(H,28,30)/b27-14+ |
| InChIKey | VZRZSLJGALTHGF-MZJWZYIUSA-N |
| XLogP | 6.22 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|