C24H29Br2N3O2 — CID 133170676
3,5-dibromo-2-hydroxy-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 133170676) has the molecular formula C24H29Br2N3O2 and a molecular weight of 551.32 g/mol. Its IUPAC name is 3,5-dibromo-2-hydroxy-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 3,5-dibromo-2-hydroxy-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 133170676 |
| Molecular Formula | C24H29Br2N3O2 |
| Molecular Weight | 551.32 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 3,5-dibromo-2-hydroxy-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | Cc1cc2c(cc1/C=N/NC(=O)c1cc(Br)cc(Br)c1O)C(C)CC(C)(C)N2C(C)C |
| InChI | InChI=1S/C24H29Br2N3O2/c1-13(2)29-21-7-14(3)16(8-18(21)15(4)11-24(29,5)6)12-27-28-23(31)19-9-17(25)10-20(26)22(19)30/h7-10,12-13,15,30H,11H2,1-6H3,(H,28,31)/b27-12+ |
| InChIKey | KYQOWXWCIFDXTP-KKMKTNMSSA-N |
| XLogP | 6.49 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.32 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|