C24H30BrN3O — CID 133170652
2-bromo-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 133170652) has the molecular formula C24H30BrN3O and a molecular weight of 456.43 g/mol. Its IUPAC name is 2-bromo-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 133170652 |
| Molecular Formula | C24H30BrN3O |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-bromo-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | Cc1cc2c(cc1/C=N/NC(=O)c1ccccc1Br)C(C)CC(C)(C)N2C(C)C |
| InChI | InChI=1S/C24H30BrN3O/c1-15(2)28-22-11-16(3)18(12-20(22)17(4)13-24(28,5)6)14-26-27-23(29)19-9-7-8-10-21(19)25/h7-12,14-15,17H,13H2,1-6H3,(H,27,29)/b26-14+ |
| InChIKey | LHOCUCBNOOBHPZ-VULFUBBASA-N |
| XLogP | 6.02 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|