C29H35N3O2 — CID 133170696
2-naphthalen-1-yloxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide (PubChem CID 133170696) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-naphthalen-1-yloxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-naphthalen-1-yloxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 133170696 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 2-naphthalen-1-yloxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
| SMILES | Cc1cc2c(cc1/C=N\NC(=O)COc1cccc3ccccc13)C(C)CC(C)(C)N2C(C)C |
| InChI | InChI=1S/C29H35N3O2/c1-19(2)32-26-14-20(3)23(15-25(26)21(4)16-29(32,5)6)17-30-31-28(33)18-34-27-13-9-11-22-10-7-8-12-24(22)27/h7-15,17,19,21H,16,18H2,1-6H3,(H,31,33)/b30-17- |
| InChIKey | BDZPDTAHAYOCHT-LQNQUEJISA-N |
| XLogP | 6.18 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|