C24H32N2O — CID 132654682
N-(2-methoxyphenyl)-1-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 132654682) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(2-methoxyphenyl)-1-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 132654682 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-(2-methoxyphenyl)-1-(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | COc1ccccc1/N=C/c1cc2c(cc1C)N(C(C)C)C(C)(C)CC2C |
| InChI | InChI=1S/C24H32N2O/c1-16(2)26-22-12-17(3)19(13-20(22)18(4)14-24(26,5)6)15-25-21-10-8-9-11-23(21)27-7/h8-13,15-16,18H,14H2,1-7H3/b25-15+ |
| InChIKey | KJAUHBJZAPWCJK-MFKUBSTISA-N |
| XLogP | 6.25 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|