C29H34N2O2 — CID 99865775
1-[(4S)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]-N-[4-(2-methoxyphenoxy)phenyl]methanimine (PubChem CID 99865775) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-[(4S)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]-N-[4-(2-methoxyphenoxy)phenyl]methanimine.
| Compound Name | 1-[(4S)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]-N-[4-(2-methoxyphenoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 99865775 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 1-[(4S)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]-N-[4-(2-methoxyphenoxy)phenyl]methanimine |
| SMILES | CCN1c2cc(C)c(/C=N/c3ccc(Oc4ccccc4OC)cc3)cc2[C@@H](C)CC1(C)C |
| InChI | InChI=1S/C29H34N2O2/c1-7-31-26-16-20(2)22(17-25(26)21(3)18-29(31,4)5)19-30-23-12-14-24(15-13-23)33-28-11-9-8-10-27(28)32-6/h8-17,19,21H,7,18H2,1-6H3/b30-19+/t21-/m0/s1 |
| InChIKey | PIYSNZQQXXPQPC-DDBXXPGKSA-N |
| XLogP | 7.66 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|