C26H36N2 — CID 50860708
N-(4-tert-butylphenyl)-1-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50860708) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(4-tert-butylphenyl)-1-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50860708 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CCN1c2cc(C)c(/C=N/c3ccc(C(C)(C)C)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C26H36N2/c1-9-28-24-14-18(2)20(15-23(24)19(3)16-26(28,7)8)17-27-22-12-10-21(11-13-22)25(4,5)6/h10-15,17,19H,9,16H2,1-8H3/b27-17+ |
| InChIKey | LXIQGMODIDFQCV-WPWMEQJKSA-N |
| XLogP | 7.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|