C22H28N2 — CID 124631427
1-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]-N-phenylmethanimine (PubChem CID 124631427) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]-N-phenylmethanimine.
| Compound Name | 1-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]-N-phenylmethanimine |
|---|---|
| PubChem CID | 124631427 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]-N-phenylmethanimine |
| SMILES | CCN1c2cc(C)c(/C=N/c3ccccc3)cc2[C@H](C)CC1(C)C |
| InChI | InChI=1S/C22H28N2/c1-6-24-21-12-16(2)18(15-23-19-10-8-7-9-11-19)13-20(21)17(3)14-22(24,4)5/h7-13,15,17H,6,14H2,1-5H3/b23-15+/t17-/m1/s1 |
| InChIKey | MFQAQYCQCLEYKS-HAFIMRKLSA-N |
| XLogP | 5.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|