C22H27N3O2 — CID 99885742
2-hydroxy-N-[(E)-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]benzamide (PubChem CID 99885742) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]benzamide.
| Compound Name | 2-hydroxy-N-[(E)-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 99885742 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 2-hydroxy-N-[(E)-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]benzamide |
| SMILES | Cc1cc2c(cc1/C=N/NC(=O)c1ccccc1O)[C@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C22H27N3O2/c1-14-10-19-18(15(2)12-22(3,4)25(19)5)11-16(14)13-23-24-21(27)17-8-6-7-9-20(17)26/h6-11,13,15,26H,12H2,1-5H3,(H,24,27)/b23-13+/t15-/m1/s1 |
| InChIKey | GUUDYINHRIADLW-LJGKHRNASA-N |
| XLogP | 4.19 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|