C24H28F3N3O2 — CID 50862000
N-[(Z)-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 50862000) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 50862000 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[(Z)-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | CCN1c2cc(OC)c(/C=N\NC(=O)c3cccc(C(F)(F)F)c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H28F3N3O2/c1-6-30-20-12-21(32-5)17(11-19(20)15(2)13-23(30,3)4)14-28-29-22(31)16-8-7-9-18(10-16)24(25,26)27/h7-12,14-15H,6,13H2,1-5H3,(H,29,31)/b28-14- |
| InChIKey | PPNSXRQLUNECHZ-MUXKCCDJSA-N |
| XLogP | 5.59 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|