C21H27N3O3 — CID 50861871
N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]furan-2-carboxamide (PubChem CID 50861871) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 50861871 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]furan-2-carboxamide |
| SMILES | CCN1c2cc(OC)c(/C=N/NC(=O)c3ccco3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C21H27N3O3/c1-6-24-17-11-19(26-5)15(10-16(17)14(2)12-21(24,3)4)13-22-23-20(25)18-8-7-9-27-18/h7-11,13-14H,6,12H2,1-5H3,(H,23,25)/b22-13+ |
| InChIKey | PTTRTBLNAOHWKL-LPYMAVHISA-N |
| XLogP | 4.16 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|