C25H31Br2N3O3 — CID 50863929
2-(2,4-dibromophenoxy)-N-[(E)-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50863929) has the molecular formula C25H31Br2N3O3 and a molecular weight of 581.35 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[(E)-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[(E)-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50863929 |
| Molecular Formula | C25H31Br2N3O3 |
| Molecular Weight | 581.35 g/mol |
| Exact Mass | 579.07 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[(E)-(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CCCN1c2cc(OC)c(/C=N/NC(=O)COc3ccc(Br)cc3Br)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C25H31Br2N3O3/c1-6-9-30-21-12-23(32-5)17(10-19(21)16(2)13-25(30,3)4)14-28-29-24(31)15-33-22-8-7-18(26)11-20(22)27/h7-8,10-12,14,16H,6,9,13,15H2,1-5H3,(H,29,31)/b28-14+ |
| InChIKey | ZVXZGQCJXBHRIO-CCVNUDIWSA-N |
| XLogP | 6.25 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.35 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|