C26H35FN4O2 — CID 50863316
2-[3-(dimethylamino)phenoxy]-N-[(E)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50863316) has the molecular formula C26H35FN4O2 and a molecular weight of 454.59 g/mol. Its IUPAC name is 2-[3-(dimethylamino)phenoxy]-N-[(E)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-[3-(dimethylamino)phenoxy]-N-[(E)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50863316 |
| Molecular Formula | C26H35FN4O2 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 2-[3-(dimethylamino)phenoxy]-N-[(E)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CCCN1c2cc(F)c(/C=N/NC(=O)COc3cccc(N(C)C)c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C26H35FN4O2/c1-7-11-31-24-14-23(27)19(12-22(24)18(2)15-26(31,3)4)16-28-29-25(32)17-33-21-10-8-9-20(13-21)30(5)6/h8-10,12-14,16,18H,7,11,15,17H2,1-6H3,(H,29,32)/b28-16+ |
| InChIKey | TUCDAHTXZUBWSQ-LQKURTRISA-N |
| XLogP | 4.92 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|