C25H32FN3O2S — CID 50863222
N-[(E)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide (PubChem CID 50863222) has the molecular formula C25H32FN3O2S and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[(E)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide.
| Compound Name | N-[(E)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 50863222 |
| Molecular Formula | C25H32FN3O2S |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[(E)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide |
| SMILES | CCCN1c2cc(F)c(/C=N/NC(=O)CSc3ccc(OC)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C25H32FN3O2S/c1-6-11-29-23-13-22(26)18(12-21(23)17(2)14-25(29,3)4)15-27-28-24(30)16-32-20-9-7-19(31-5)8-10-20/h7-10,12-13,15,17H,6,11,14,16H2,1-5H3,(H,28,30)/b27-15+ |
| InChIKey | UCZOQYRHYOEYNS-JFLMPSFJSA-N |
| XLogP | 5.58 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|