C24H31N3O2 — CID 50862187
4-methoxy-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50862187) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-methoxy-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 4-methoxy-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50862187 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 4-methoxy-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2ccc(/C=N\NC(=O)c3ccc(OC)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H31N3O2/c1-6-13-27-22-12-7-18(14-21(22)17(2)15-24(27,3)4)16-25-26-23(28)19-8-10-20(29-5)11-9-19/h7-12,14,16-17H,6,13,15H2,1-5H3,(H,26,28)/b25-16- |
| InChIKey | IDDMZKFOFIAHGN-XYGWBWBKSA-N |
| XLogP | 4.96 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|