C23H30N4O — CID 50862117
1-phenyl-3-[(E)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]urea (PubChem CID 50862117) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-phenyl-3-[(E)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]urea.
| Compound Name | 1-phenyl-3-[(E)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 50862117 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-phenyl-3-[(E)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]urea |
| SMILES | CCCN1c2ccc(/C=N/NC(=O)Nc3ccccc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C23H30N4O/c1-5-13-27-21-12-11-18(14-20(21)17(2)15-23(27,3)4)16-24-26-22(28)25-19-9-7-6-8-10-19/h6-12,14,16-17H,5,13,15H2,1-4H3,(H2,25,26,28)/b24-16+ |
| InChIKey | OYCLDDSWIHHGDM-LFVJCYFKSA-N |
| XLogP | 5.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|