C27H31N3O — CID 50862138
N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 50862138) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 50862138 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | CCCN1c2ccc(/C=N\NC(=O)c3ccc4ccccc4c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C27H31N3O/c1-5-14-30-25-13-10-20(15-24(25)19(2)17-27(30,3)4)18-28-29-26(31)23-12-11-21-8-6-7-9-22(21)16-23/h6-13,15-16,18-19H,5,14,17H2,1-4H3,(H,29,31)/b28-18- |
| InChIKey | RWGVEWRZJFBWHV-VEILYXNESA-N |
| XLogP | 6.11 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|