C29H36N4O — CID 50862171
4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50862171) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50862171 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2ccc(/C=N\NC(=O)c3ccc(-n4c(C)ccc4C)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C29H36N4O/c1-7-16-32-27-15-10-23(17-26(27)20(2)18-29(32,5)6)19-30-31-28(34)24-11-13-25(14-12-24)33-21(3)8-9-22(33)4/h8-15,17,19-20H,7,16,18H2,1-6H3,(H,31,34)/b30-19- |
| InChIKey | LCOFVSGEUVZHSQ-FSGOGVSDSA-N |
| XLogP | 6.36 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|