C27H32N4O — CID 50862180
2-pyrrol-1-yl-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50862180) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-pyrrol-1-yl-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 2-pyrrol-1-yl-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50862180 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 2-pyrrol-1-yl-N-[(Z)-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2ccc(/C=N\NC(=O)c3ccccc3-n3cccc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C27H32N4O/c1-5-14-31-25-13-12-21(17-23(25)20(2)18-27(31,3)4)19-28-29-26(32)22-10-6-7-11-24(22)30-15-8-9-16-30/h6-13,15-17,19-20H,5,14,18H2,1-4H3,(H,29,32)/b28-19- |
| InChIKey | XSGFSDIATFCHAA-USHMODERSA-N |
| XLogP | 5.74 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|