C25H27FN4O — CID 50859397
N-[(Z)-(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-pyrrol-1-ylbenzamide (PubChem CID 50859397) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[(Z)-(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-pyrrol-1-ylbenzamide.
| Compound Name | N-[(Z)-(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 50859397 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[(Z)-(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-pyrrol-1-ylbenzamide |
| SMILES | CC1CC(C)(C)N(C)c2cc(F)c(/C=N\NC(=O)c3ccccc3-n3cccc3)cc21 |
| InChI | InChI=1S/C25H27FN4O/c1-17-15-25(2,3)29(4)23-14-21(26)18(13-20(17)23)16-27-28-24(31)19-9-5-6-10-22(19)30-11-7-8-12-30/h5-14,16-17H,15H2,1-4H3,(H,28,31)/b27-16- |
| InChIKey | JGNVRTLSEOLRET-YUMHPJSZSA-N |
| XLogP | 5.10 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|