C26H29BrFN3O3 — CID 50863300
5-bromo-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 50863300) has the molecular formula C26H29BrFN3O3 and a molecular weight of 530.44 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 50863300 |
| Molecular Formula | C26H29BrFN3O3 |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 5-bromo-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | CCCN1c2cc(F)c(/C=N\NC(=O)c3cc4cc(Br)cc(OC)c4o3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C26H29BrFN3O3/c1-6-7-31-21-12-20(28)17(9-19(21)15(2)13-26(31,3)4)14-29-30-25(32)23-10-16-8-18(27)11-22(33-5)24(16)34-23/h8-12,14-15H,6-7,13H2,1-5H3,(H,30,32)/b29-14- |
| InChIKey | HIHAHKXWKFNJCK-NUJZUDFISA-N |
| XLogP | 6.61 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|