C25H28BrN3O3 — CID 133170399
5-bromo-N-[(E)-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 133170399) has the molecular formula C25H28BrN3O3 and a molecular weight of 498.42 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 133170399 |
| Molecular Formula | C25H28BrN3O3 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 5-bromo-N-[(E)-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | CCN1c2ccc(/C=N/NC(=O)c3cc4cc(Br)cc(OC)c4o3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C25H28BrN3O3/c1-6-29-20-8-7-16(9-19(20)15(2)13-25(29,3)4)14-27-28-24(30)22-11-17-10-18(26)12-21(31-5)23(17)32-22/h7-12,14-15H,6,13H2,1-5H3,(H,28,30)/b27-14+ |
| InChIKey | KIEYLIFTBMZBDX-MZJWZYIUSA-N |
| XLogP | 6.08 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|